MPOD logo

View Datafile


Datafile info
code : 1000043
filename : 1000043.mpod
cod code : None
phase generic : PMN-PT
phase name : Pb(Mg1/3Nb2/3)O3-PbTiO3(0.28)
chemical formula : Pb Nb0.48 Mg0.24 Ti0.28 O3
publication : 24
symmetry point group name H-M : 3m


General experimental conditions/parameters
measurement poling : [011]c
frame : 1=[0-11]c

Other experimental conditions/parameters

Properties' values
piezoelectric dij [m.V^-1]
0 0 0 0 2816(41) 0
0 0 0 234(13) 0 0
723(20) -1761(13) 1766(47) 0 0 0

elastic compliance sijD [10^-12.Pa^-1]
10.0(5) -3.5(1.2) -15.3(5) 0 0 0
-3.5(1.2) 26.7(3) -6.6(9) 0 0 0
-15.3(5) -6.6(9) 11.0(4) 0 0 0
0 0 0 12.7(6) 0 0
0 0 0 0 27.0(2) 0
0 0 0 0 0 17.2(5)

elastic compliance sijE [10^-12.Pa^-1]
19.2(3) -26.1(6) -61.8(7) 0 0 0
-26.1(6) 82(3) -61.8(7) 0 0 0
-61.8(7) -61.8(7) 67(2) 0 0 0
0 0 0 14.0(7) 0 0
0 0 0 0 147(7) 0
0 0 0 0 0 17.2(5)

electromechanical coupling kij
0 0 0 0 0.900(4) 0
0 0 0 0.300(4) 0 0
0.65(2) 0.89(1) 0.910(4) 0 0 0

piezoelectric hij [V.m.N^-1]
0 0 0 0 16.5(4) 0
0 0 0 9.6(2) 0 0
29(3) -11.7(7) 31(1) 0 0 0

piezoelectric eij [C.N^-1]
0 0 0 0 18.2(5) 0
0 0 0 7.7(3) 0 0
15.1(7) -6.21(1) 16.5(4) 0 0 0

piezoelectric gij [C.m^-2]
0 0 0 0 4.3(2) 0
0 0 0 0.56(1) 0 0
1.28(4) -3.1(1) 3.13(4) 0 0 0

elastic stiffness cijD [GPa]
311(2) 189(6) 158(3) 0 0 0
189(6) 208(7) 144(4) 0 0 0
158(3) 144(4) 199.0(8) 0 0 0
0 0 0 79(3) 0 0
0 0 0 0 37.0(2) 0
0 0 0 0 0 58(1)

elastic stiffness cijE [GPa]
268(16) 207(6) 162(6) 0 0 0
207(6) 201(7) 164(3) 0 0 0
162(6) 164(3) 148(1) 0 0 0
0 0 0 71(3) 0 0
0 0 0 0 6.8(1) 0
0 0 0 0 0 58(1)

Other experimental conditions/parameters

Properties' values
dielectric permittivity relative epsrijT
7466(188) 0 0
0 4713(228) 0
0 0 6366(205)

dielectric stiffness relative betrijT [10^-4]
1.34(3) 0 0
0 2.12(10) 0
0 0 1.57(5)

Other experimental conditions/parameters

Properties' values
dielectric stiffness relative betrijS [10^-4]
8.1(5) 0 0
0 11.0(5) 0
0 0 17(1)

dielectric permittivity relative epsrijS
1244(75) 0 0
0 905(41) 0
0 0 600(40)