MPOD logo

View Datafile


Datafile info
code : 1000045
filename : 1000045.mpod
cod code : None
phase generic : PMN-PT
phase name : Pb(Mg1/3Nb2/3)O3-PbTiO3(0.30)
chemical formula : Pb Nb0.467 Mg0.233 Ti0.30 O3
publication : 24
symmetry point group name H-M : 3m


General experimental conditions/parameters
measurement poling : [011]c
frame : 1=[0-11]c

Other experimental conditions/parameters

Properties' values
piezoelectric dij [m.V^-1]
0 0 0 0 3262(56) 0
0 0 0 289(8) 0 0
813(26) -2116(84) 1916(62) 0 0 0

elastic compliance sijD [10^-12.Pa^-1]
13(1.5) -5.5(2) -16(2) 0 0 0
-5.5(2) 25(2) -3.3(1.7) 0 0 0
-16(2) -3.3(1.7) 10.7(7) 0 0 0
0 0 0 11.90(7) 0 0
0 0 0 0 14.2(9) 0
0 0 0 0 0 20(2)

elastic compliance sijE [10^-12.Pa^-1]
23.3(4) -33(1) 9.3(2) 0 0 0
-33(1) 98(2) -69(1) 0 0 0
9.3(2) -69(1) 73(1) 0 0 0
0 0 0 13.70(8) 0 0
0 0 0 0 151(2) 0
0 0 0 0 0 20(2)

electromechanical coupling kij
0 0 0 0 0.950(2) 0
0 0 0 0.360(4) 0 0
0.710(9) 0.940(8) 0.920(4) 0 0 0

piezoelectric hij [V.m.N^-1]
0 0 0 0 22.6(3) 0
0 0 0 10.1(2) 0 0
15.2(2) -5.9(8) 29.3(8) 0 0 0

piezoelectric eij [C.N^-1]
0 0 0 0 28(2) 0
0 0 0 10.9(4) 0 0
10(2) -4.0(5) 19.8(6) 0 0 0

piezoelectric gij [C.m^-2]
0 0 0 0 4.19(3) 0
0 0 0 0.63(1) 0 0
1.32(9) -3.43(1) 3.11(1) 0 0 0

elastic stiffness cijD [GPa]
322(19) 228(12) 213(7) 0 0 0
228(12) 213(5) 158(3) 0 0 0
213(7) 158(3) 210(1) 0 0 0
0 0 0 84.0(5) 0 0
0 0 0 0 70.3(5) 0
0 0 0 0 0 50.0(5)

elastic stiffness cijE [GPa]
306(19) 234(11) 169(2) 0 0 0
234(11) 211(5) 183(7) 0 0 0
169(2) 183(7) 151(1) 0 0 0
0 0 0 72.9(4) 0 0
0 0 0 0 6.6(1) 0
0 0 0 0 0 50(5)

Other experimental conditions/parameters

Properties' values
dielectric permittivity relative epsrijT
8783(209) 0 0
0 5233(169) 0
0 0 6966(262)

dielectric stiffness relative betrijT [10^-4]
1.13(2) 0 0
0 1.91(6) 0
0 0 1.43(5)

Other experimental conditions/parameters

Properties' values
dielectric stiffness relative betrijS [10^-4]
7.14(4) 0 0
0 8.2(5) 0
0 0 13.0(7)

dielectric permittivity relative epsrijS
1405(88) 0 0
0 1216(65) 0
0 0 766(40)