MPOD logo

View Datafile


Datafile info
code : 1000046
filename : 1000046.mpod
cod code : None
phase generic : PMN-PT
phase name : Pb(Mg1/3Nb2/3)O3-PbTiO3(0.32)
chemical formula : Pb Nb0.453 Mg0.227 Ti0.32 O3
publication : 24
symmetry point group name H-M : mm2


General experimental conditions/parameters
measurement poling : [011]c
frame : 1=[0-11]c

Other experimental conditions/parameters

Properties' values
piezoelectric dij [m.V^-1]
0 0 0 0 526(27) 0
0 0 0 78(1) 0 0
170(18) -460(21) 1018(33) 0 0 0

elastic compliance sijD [10^-12.Pa^-1]
8.1(1) -9.2(2) -1.5(3) 0 0 0
-9.2(2) 20.2(3) -2.7(1.3) 0 0 0
-1.5(3) -2.7(1.3) 6.3(7) 0 0 0
0 0 0 11.7(1) 0 0
0 0 0 0 21.4(6) 0
0 0 0 0 0 76.5(9)

elastic compliance sijE [10^-12.Pa^-1]
8.9(1) -12.4(3) 5.6(3) 0 0 0
-12.4(3) 28.3(4) -20.6(5) 0 0 0
5.6(3) -20.6(5) 24.2(3) 0 0 0
0 0 0 11.9(1) 0 0
0 0 0 0 30(1) 0
0 0 0 0 0 76.5(9)

electromechanical coupling kij
0 0 0 0 0.52(1) 0
0 0 0 0.140(5) 0 0
0.310(8) 0.55(1) 0.86(2) 0 0 0

piezoelectric hij [V.m.N^-1]
0 0 0 0 12.7(2) 0
0 0 0 5.2(3) 0 0
48(7) -19(4) 20.4(6) 0 0 0

piezoelectric eij [C.N^-1]
0 0 0 0 10.2(3) 0
0 0 0 3.39(6) 0 0
25.9(3) -10(2) 11.1(8) 0 0 0

piezoelectric gij [C.m^-2]
0 0 0 0 1.56(6) 0
0 0 0 0.32(2) 0 0
0.70(2) -1.75(7) 3.9(2) 0 0 0

elastic stiffness cijD [GPa]
570(15) 258(26) 209(5) 0 0 0
258(26) 325(6) 162(5) 0 0 0
209(5) 162(5) 181(3) 0 0 0
0 0 0 85(8) 0 0
0 0 0 0 47(1) 0
0 0 0 0 0 13(2)

elastic stiffness cijE [GPa]
444(32) 309(13) 157(4) 0 0 0
309(13) 304(7) 164(3) 0 0 0
157(4) 164(3) 157(2) 0 0 0
0 0 0 83.4(4) 0 0
0 0 0 0 34(1) 0
0 0 0 0 0 13(2)

Other experimental conditions/parameters

Properties' values
dielectric permittivity relative epsrijT
3803(85) 0 0
0 2783(209) 0
0 0 2966(124)

dielectric stiffness relative betrijT [10^-4]
2.63(5) 0 0
0 3.6(3) 0
0 0 3.4(1)

Other experimental conditions/parameters

Properties' values
dielectric stiffness relative betrijS [10^-4]
11.1(5) 0 0
0 13.4(6) 0
0 0 16.3(6)

dielectric permittivity relative epsrijS
900(40) 0 0
0 743(33) 0
0 0 613(26)