MPOD logo

View Datafile


Datafile info
code : 1000047
filename : 1000047.mpod
cod code : None
phase generic : PMN-PT
phase name : Pb(Mg1/3Nb2/3)O3-PbTiO3(0.33)
chemical formula : Pb Nb0.447 Mg0.223 Ti0.33 O3
publication : 26
symmetry point group name H-M : 3m


General experimental conditions/parameters
measurement poling : [001]c
frame : 1=[100]c

Other experimental conditions/parameters

Properties' values
piezoelectric dij [m.V^-1]
0 0 0 0 146(16) 0
0 0 0 146(16) 0 0
-1330(19) -1330(19) 2820(75) 0 0 0

elastic compliance sijD [10^-12.Pa^-1]
44(1) -34(1) -4.1(1) 0 0 0
-34(1) 44(1) -4.1(1) 0 0 0
-4.1(1) -4.1(1) 11.1(8) 0 0 0
0 0 0 13.0(1) 0 0
0 0 0 0 13.0(1) 0
0 0 0 0 0 15.2(2)

elastic compliance sijE [10^-12.Pa^-1]
69(2) -11(1) -56(1) 0 0 0
-11(1) 69(2) -56(1) 0 0 0
-56(1) -56(1) 120(4) 0 0 0
0 0 0 14.5(1) 0 0
0 0 0 0 14.5(1) 0
0 0 0 0 0 15.2(2)

electromechanical coupling kij
0 0 0 0 0.32(2) 0
0 0 0 0.32(2) 0 0
0.59(1) 0.59(1) 0.94(1) 0 0 0

piezoelectric hij [V.m.N^-1]
0 0 0 0 7.9(4) 0
0 0 0 7.9(4) 0 0
-6(2) -6(2) 34(2) 0 0 0

piezoelectric eij [C.N^-1]
0 0 0 0 10.1(9) 0
0 0 0 10.1(9) 0 0
-3.9(2) -3.9(2) 20.3(2) 0 0 0

piezoelectric gij [C.m^-2]
0 0 0 0 1.03(6) 0
0 0 0 1.03(6) 0 0
-1.84(4) -1.84(4) 3.88(8) 0 0 0

elastic stiffness cijD [GPa]
117(2) 105(2) 90(4) 0 0 0
105(2) 117(2) 90(4) 0 0 0
90(4) 90(4) 174(5) 0 0 0
0 0 0 77.0(5) 0 0
0 0 0 0 77.0(5) 0
0 0 0 0 0 66.0(5)

elastic stiffness cijE [GPa]
115(2) 103(2) 102(2) 0 0 0
103(2) 115(2) 102(2) 0 0 0
102(2) 102(2) 103(3) 0 0 0
0 0 0 69.0(5) 0 0
0 0 0 0 69.0(5) 0
0 0 0 0 0 66.0(5)

Other experimental conditions/parameters

Properties' values
dielectric permittivity relative epsrijT
1600(120) 0 0
0 1600(120) 0
0 0 8200(200)

dielectric stiffness relative betrijT [10^-4]
6.3(1) 0 0
0 6.3(1) 0
0 0 1.2(1)

Other experimental conditions/parameters

Properties' values
dielectric stiffness relative betrijS [10^-4]
7.0(1) 0 0
0 7.0(1) 0
0 0 14.7(5)

dielectric permittivity relative epsrijS
1434(110) 0 0
0 1434(110) 0
0 0 680(45)