MPOD logo

View Datafile


Datafile info
code : 1000050
filename : 1000050.mpod
cod code : None
phase generic : PZN-PT
phase name : Pb(Zn1/3Nb2/3)O3-PbTiO3(0.07)
chemical formula : Pb Nb0.62 Zn0.31 Ti0.07 O3
publication : 28
symmetry point group name H-M : 3m


General experimental conditions/parameters
measurement poling : [001]c
frame : 1=[100]c

Other experimental conditions/parameters

Properties' values
piezoelectric dij [m.V^-1]
0 0 0 0 176 0
0 0 0 176 0 0
-1204 -1204 2455 0 0 0

elastic compliance sijD [10^-12.Pa^-1]
56.7 -43.3 -9.6 0 0 0
-43.3 56.7 -9.6 0 0 0
-9.6 -9.6 20.9 0 0 0
0 0 0 14.7 0 0
0 0 0 0 14.7 0
0 0 0 0 0 14.1

elastic compliance sijE [10^-12.Pa^-1]
85.9 -14.1 -69 0 0 0
-14.1 85.9 -69 0 0 0
-69 -69 142 0 0 0
0 0 0 15.9 0 0
0 0 0 0 15.9 0
0 0 0 0 0 14.1

electromechanical coupling kij
0 0 0 0 0.23 0
0 0 0 0.23 0 0
0.50 0.50 0.91 0 0 0

piezoelectric hij [V.m.N^-1]
0 0 0 0 4.5 0
0 0 0 4.5 0 0
-3.1 -3.1 20.7 0 0 0

piezoelectric eij [C.N^-1]
0 0 0 0 11.1 0
0 0 0 11.1 0 0
-2.3 -2.3 15.1 0 0 0

piezoelectric gij [C.m^-2]
0 0 0 0 0.66 0
0 0 0 0.66 0 0
-2.42 -2.42 4.93 0 0 0

elastic stiffness cijD [GPa]
113.7 103.7 100 0 0 0
103.7 113.7 100 0 0 0
100 100 140 0 0 0
0 0 0 68 0 0
0 0 0 0 68 0
0 0 0 0 0 71

elastic stiffness cijE [GPa]
113 103 105 0 0 0
103 113 105 0 0 0
105 105 109.1 0 0 0
0 0 0 63 0 0
0 0 0 0 63 0
0 0 0 0 0 71

Other experimental conditions/parameters

Properties' values
dielectric permittivity relative epsrijT
3000 0 0
0 3000 0
0 0 5622

dielectric stiffness relative betrijT [10^-4]
3.33 0 0
0 3.33 0
0 0 1.78

Other experimental conditions/parameters

Properties' values
dielectric permittivity relative epsrijT
2779 0 0
0 2779 0
0 0 823

dielectric stiffness relative betrijS [10^-4]
3.6 0 0
0 3.6 0
0 0 12.2