MPOD logo

View Datafile


Datafile info
code : 1000049
filename : 1000049.mpod
cod code : None
phase generic : PZN-PT
phase name : Pb(Zn1/3Nb2/3)O3-PbTiO3(0.045)
chemical formula : Pb Nb0.637 Zn0.318 Ti0.07 O3
publication : 28
symmetry point group name H-M : 3m


General experimental conditions/parameters
measurement poling : [001]c
frame : 1=[100]c

Other experimental conditions/parameters

Properties' values
piezoelectric dij [m.V^-1]
0 0 0 0 140 0
0 0 0 140 0 0
-970 -970 2000 0 0 0

elastic compliance sijD [10^-12.Pa^-1]
61.5 -49 -9 0 0 0
-49 61.5 -9 0 0 0
-9 -9 20.6 0 0 0
0 0 0 14.9 0 0
0 0 0 0 14.9 0
0 0 0 0 0 15.9

elastic compliance sijE [10^-12.Pa^-1]
82 -28.5 -51 0 0 0
-28.5 82 -51 0 0 0
-51 -51 108 0 0 0
0 0 0 15.6 0 0
0 0 0 0 15.6 0
0 0 0 0 0 15.9

electromechanical coupling kij
0 0 0 0 0.23 0
0 0 0 0.23 0 0
0.50 0.50 0.91 0 0 0

piezoelectric hij [V.m.N^-1]
0 0 0 0 3.4 0
0 0 0 3.4 0 0
-4.3 -4.3 17 0 0 0

piezoelectric eij [C.N^-1]
0 0 0 0 8.9 0
0 0 0 8.9 0 0
-3.7 -3.7 15 0 0 0

piezoelectric gij [C.m^-2]
0 0 0 0 0.5 0
0 0 0 0.5 0 0
-2.1 -2.1 4.4 0 0 0

elastic stiffness cijD [GPa]
113 104 95 0 0 0
104 113 95 0 0 0
95 95 135 0 0 0
0 0 0 67 0 0
0 0 0 0 67 0
0 0 0 0 0 63

elastic stiffness cijE [GPa]
111 102 101 0 0 0
102 111 101 0 0 0
101 101 105 0 0 0
0 0 0 64 0 0
0 0 0 0 64 0
0 0 0 0 0 63

Other experimental conditions/parameters

Properties' values
dielectric permittivity relative epsrijT
3100 0 0
0 3100 0
0 0 5200

dielectric stiffness relative betrijT [10^-4]
3.2 0 0
0 3.2 0
0 0 1.9

Other experimental conditions/parameters

Properties' values
dielectric permittivity relative epsrijT
3000 0 0
0 3000 0
0 0 1000

dielectric stiffness relative betrijS [10^-4]
3.4 0 0
0 3.4 0
0 0 10.0